C19H13F3N6O2 — CID 11546108
N-[(E)-furan-2-ylmethylideneamino]-5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazole-4-carboxamide (PubChem CID 11546108) has the molecular formula C19H13F3N6O2 and a molecular weight of 414.35 g/mol. Its IUPAC name is N-[(E)-furan-2-ylmethylideneamino]-5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazole-4-carboxamide.
| Compound Name | N-[(E)-furan-2-ylmethylideneamino]-5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 11546108 |
| Molecular Formula | C19H13F3N6O2 |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[(E)-furan-2-ylmethylideneamino]-5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N/N=C/c2ccco2)nnn1-c1ccnc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C19H13F3N6O2/c1-11-16(18(29)26-24-10-12-4-3-9-30-12)25-27-28(11)15-7-8-23-17-13(15)5-2-6-14(17)19(20,21)22/h2-10H,1H3,(H,26,29)/b24-10+ |
| InChIKey | FPOZVWDPTJKVEP-YSURURNPSA-N |
| XLogP | 3.50 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|