C23H16F6N6O2 — CID 162667465
1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-N-[(E)-(4-methoxyphenyl)methylideneamino]-5-methyltriazole-4-carboxamide (PubChem CID 162667465) has the molecular formula C23H16F6N6O2 and a molecular weight of 522.41 g/mol. Its IUPAC name is 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-N-[(E)-(4-methoxyphenyl)methylideneamino]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-N-[(E)-(4-methoxyphenyl)methylideneamino]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 162667465 |
| Molecular Formula | C23H16F6N6O2 |
| Molecular Weight | 522.41 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-N-[(E)-(4-methoxyphenyl)methylideneamino]-5-methyltriazole-4-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2nnn(-c3cc(C(F)(F)F)nc4c(C(F)(F)F)cccc34)c2C)cc1 |
| InChI | InChI=1S/C23H16F6N6O2/c1-12-19(21(36)33-30-11-13-6-8-14(37-2)9-7-13)32-34-35(12)17-10-18(23(27,28)29)31-20-15(17)4-3-5-16(20)22(24,25)26/h3-11H,1-2H3,(H,33,36)/b30-11+ |
| InChIKey | KANPDYWACVXDDX-KNBZMSCYSA-N |
| XLogP | 4.93 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|