C17H13F3N4O — CID 6001335
3-methyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 6001335) has the molecular formula C17H13F3N4O and a molecular weight of 346.31 g/mol. Its IUPAC name is 3-methyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 3-methyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 6001335 |
| Molecular Formula | C17H13F3N4O |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 3-methyl-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | Cc1c(C(=O)N/N=C\c2ccc(C(F)(F)F)cc2)nc2ccccn12 |
| InChI | InChI=1S/C17H13F3N4O/c1-11-15(22-14-4-2-3-9-24(11)14)16(25)23-21-10-12-5-7-13(8-6-12)17(18,19)20/h2-10H,1H3,(H,23,25)/b21-10- |
| InChIKey | YJJHWBQSEMISOH-FBHDLOMBSA-N |
| XLogP | 3.43 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|