C16H14N4O3 — CID 2473778
N-[(3,4-dihydroxyphenyl)methylideneamino]-3-methylimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 2473778) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is N-[(3,4-dihydroxyphenyl)methylideneamino]-3-methylimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[(3,4-dihydroxyphenyl)methylideneamino]-3-methylimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 2473778 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-[(3,4-dihydroxyphenyl)methylideneamino]-3-methylimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | Cc1c(C(=O)NN=Cc2ccc(O)c(O)c2)nc2ccccn12 |
| InChI | InChI=1S/C16H14N4O3/c1-10-15(18-14-4-2-3-7-20(10)14)16(23)19-17-9-11-5-6-12(21)13(22)8-11/h2-9,21-22H,1H3,(H,19,23) |
| InChIKey | QNVMVRKEHKGLNF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|