C19H16N6O6 — CID 4136570
4-N,5-N-bis[(3,4-dihydroxyphenyl)methylideneamino]-1H-imidazole-4,5-dicarboxamide (PubChem CID 4136570) has the molecular formula C19H16N6O6 and a molecular weight of 424.37 g/mol. Its IUPAC name is 4-N,5-N-bis[(3,4-dihydroxyphenyl)methylideneamino]-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 4-N,5-N-bis[(3,4-dihydroxyphenyl)methylideneamino]-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 4136570 |
| Molecular Formula | C19H16N6O6 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 4-N,5-N-bis[(3,4-dihydroxyphenyl)methylideneamino]-1H-imidazole-4,5-dicarboxamide |
| SMILES | O=C(NN=Cc1ccc(O)c(O)c1)c1nc[nH]c1C(=O)NN=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H16N6O6/c26-12-3-1-10(5-14(12)28)7-22-24-18(30)16-17(21-9-20-16)19(31)25-23-8-11-2-4-13(27)15(29)6-11/h1-9,26-29H,(H,20,21)(H,24,30)(H,25,31) |
| InChIKey | DLSCFZBOMPEBES-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 192.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|