C13H13N5O5 — CID 135637254
N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-5-nitro-1H-imidazole-4-carboxamide (PubChem CID 135637254) has the molecular formula C13H13N5O5 and a molecular weight of 319.28 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-5-nitro-1H-imidazole-4-carboxamide.
| Compound Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-5-nitro-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 135637254 |
| Molecular Formula | C13H13N5O5 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-5-nitro-1H-imidazole-4-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2nc[nH]c2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C13H13N5O5/c1-22-9-4-3-8(5-10(9)23-2)6-16-17-13(19)11-12(18(20)21)15-7-14-11/h3-7H,1-2H3,(H,14,15)(H,17,19)/b16-6+ |
| InChIKey | QDUICCBYOJVCNZ-OMCISZLKSA-N |
| XLogP | 1.10 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|