C15H18N6O3 — CID 135444005
N-[[4-(diethylamino)phenyl]methylideneamino]-5-nitro-1H-imidazole-4-carboxamide (PubChem CID 135444005) has the molecular formula C15H18N6O3 and a molecular weight of 330.35 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methylideneamino]-5-nitro-1H-imidazole-4-carboxamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methylideneamino]-5-nitro-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 135444005 |
| Molecular Formula | C15H18N6O3 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methylideneamino]-5-nitro-1H-imidazole-4-carboxamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)c2nc[nH]c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H18N6O3/c1-3-20(4-2)12-7-5-11(6-8-12)9-18-19-15(22)13-14(21(23)24)17-10-16-13/h5-10H,3-4H2,1-2H3,(H,16,17)(H,19,22) |
| InChIKey | XYPMSGYJGZEJPC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|