C20H13F3N4O2 — CID 11567471
(E)-3-(furan-2-yl)-1-[5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazol-4-yl]prop-2-en-1-one (PubChem CID 11567471) has the molecular formula C20H13F3N4O2 and a molecular weight of 398.34 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-1-[5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazol-4-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(furan-2-yl)-1-[5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazol-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 11567471 |
| Molecular Formula | C20H13F3N4O2 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (E)-3-(furan-2-yl)-1-[5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazol-4-yl]prop-2-en-1-one |
| SMILES | Cc1c(C(=O)/C=C/c2ccco2)nnn1-c1ccnc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C20H13F3N4O2/c1-12-18(17(28)8-7-13-4-3-11-29-13)25-26-27(12)16-9-10-24-19-14(16)5-2-6-15(19)20(21,22)23/h2-11H,1H3/b8-7+ |
| InChIKey | ZPNCCNTVHVFGCG-BQYQJAHWSA-N |
| XLogP | 4.63 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|