C10H14N2O2S — CID 115035700
5-methyl-2-(thian-4-yl)-1H-imidazole-4-carboxylic acid (PubChem CID 115035700) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 5-methyl-2-(thian-4-yl)-1H-imidazole-4-carboxylic acid.
| Compound Name | 5-methyl-2-(thian-4-yl)-1H-imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115035700 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 5-methyl-2-(thian-4-yl)-1H-imidazole-4-carboxylic acid |
| SMILES | Cc1[nH]c(C2CCSCC2)nc1C(=O)O |
| InChI | InChI=1S/C10H14N2O2S/c1-6-8(10(13)14)12-9(11-6)7-2-4-15-5-3-7/h7H,2-5H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | JXJZETZDAJMOET-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |