C13H12N2O2 — CID 115036624
4-(2,4-dimethylpyrimidin-5-yl)oxybenzaldehyde (PubChem CID 115036624) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-(2,4-dimethylpyrimidin-5-yl)oxybenzaldehyde.
| Compound Name | 4-(2,4-dimethylpyrimidin-5-yl)oxybenzaldehyde |
|---|---|
| PubChem CID | 115036624 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-(2,4-dimethylpyrimidin-5-yl)oxybenzaldehyde |
| SMILES | Cc1ncc(Oc2ccc(C=O)cc2)c(C)n1 |
| InChI | InChI=1S/C13H12N2O2/c1-9-13(7-14-10(2)15-9)17-12-5-3-11(8-16)4-6-12/h3-8H,1-2H3 |
| InChIKey | LKWKHDXMVDQPAP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|