C12H20O2S — CID 115036874
3,3-dimethyl-1-(thian-3-yl)cyclobutane-1-carboxylic acid (PubChem CID 115036874) has the molecular formula C12H20O2S and a molecular weight of 228.36 g/mol. Its IUPAC name is 3,3-dimethyl-1-(thian-3-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 3,3-dimethyl-1-(thian-3-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115036874 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3,3-dimethyl-1-(thian-3-yl)cyclobutane-1-carboxylic acid |
| SMILES | CC1(C)CC(C(=O)O)(C2CCCSC2)C1 |
| InChI | InChI=1S/C12H20O2S/c1-11(2)7-12(8-11,10(13)14)9-4-3-5-15-6-9/h9H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | BTGKAKKNJBXLOY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |