C15H15ClN2OPt — CID 11503730
chloroplatinum(1+);methoxyethane;1,10-phenanthroline (PubChem CID 11503730) has the molecular formula C15H15ClN2OPt and a molecular weight of 469.83 g/mol. Its IUPAC name is chloroplatinum(1+);methoxyethane;1,10-phenanthroline.
| Compound Name | chloroplatinum(1+);methoxyethane;1,10-phenanthroline |
|---|---|
| PubChem CID | 11503730 |
| Molecular Formula | C15H15ClN2OPt |
| Molecular Weight | 469.83 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | chloroplatinum(1+);methoxyethane;1,10-phenanthroline |
| SMILES | Cl[Pt+].[CH2-]COC.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C3H7O.ClH.Pt/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;1-3-4-2;;/h1-8H;1,3H2,2H3;1H;/q;-1;;+2/p-1 |
| InChIKey | VEJWCPPTYXOLDZ-UHFFFAOYSA-M |
| XLogP | 3.94 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.83 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|