C8H13N3O3S — CID 115038269
5-(3-methyl-1,1-dioxothian-3-yl)-1,2,4-oxadiazol-3-amine (PubChem CID 115038269) has the molecular formula C8H13N3O3S and a molecular weight of 231.28 g/mol. Its IUPAC name is 5-(3-methyl-1,1-dioxothian-3-yl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(3-methyl-1,1-dioxothian-3-yl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 115038269 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 5-(3-methyl-1,1-dioxothian-3-yl)-1,2,4-oxadiazol-3-amine |
| SMILES | CC1(c2nc(N)no2)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13N3O3S/c1-8(6-10-7(9)11-14-6)3-2-4-15(12,13)5-8/h2-5H2,1H3,(H2,9,11) |
| InChIKey | XPMYTMFZTKYWDU-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |