C9H15N3O — CID 107182962
5-(2,2-dimethylcyclopentyl)-1,2,4-oxadiazol-3-amine (PubChem CID 107182962) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-(2,2-dimethylcyclopentyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(2,2-dimethylcyclopentyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 107182962 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 5-(2,2-dimethylcyclopentyl)-1,2,4-oxadiazol-3-amine |
| SMILES | CC1(C)CCCC1c1nc(N)no1 |
| InChI | InChI=1S/C9H15N3O/c1-9(2)5-3-4-6(9)7-11-8(10)12-13-7/h6H,3-5H2,1-2H3,(H2,10,12) |
| InChIKey | DFFVRKXERWSXNZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |