C8H9N3O2 — CID 19968390
5-cyclopentyl-3-isocyanato-1,2,4-oxadiazole (PubChem CID 19968390) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 5-cyclopentyl-3-isocyanato-1,2,4-oxadiazole.
| Compound Name | 5-cyclopentyl-3-isocyanato-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19968390 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 5-cyclopentyl-3-isocyanato-1,2,4-oxadiazole |
| SMILES | O=C=Nc1noc(C2CCCC2)n1 |
| InChI | InChI=1S/C8H9N3O2/c12-5-9-8-10-7(13-11-8)6-3-1-2-4-6/h6H,1-4H2 |
| InChIKey | KVUOBPSAAASDSR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 68.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|