C7H11N3O — CID 53418487
5-cyclopentyl-1,2,4-oxadiazol-3-amine (PubChem CID 53418487) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is 5-cyclopentyl-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-cyclopentyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 53418487 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 5-cyclopentyl-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(C2CCCC2)n1 |
| InChI | InChI=1S/C7H11N3O/c8-7-9-6(11-10-7)5-3-1-2-4-5/h5H,1-4H2,(H2,8,10) |
| InChIKey | JCRLTRQAWGIGHZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |