C7H9IN2O — CID 112572473
5-cyclopentyl-3-iodo-1,2,4-oxadiazole (PubChem CID 112572473) has the molecular formula C7H9IN2O and a molecular weight of 264.07 g/mol. Its IUPAC name is 5-cyclopentyl-3-iodo-1,2,4-oxadiazole.
| Compound Name | 5-cyclopentyl-3-iodo-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 112572473 |
| Molecular Formula | C7H9IN2O |
| Molecular Weight | 264.07 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 5-cyclopentyl-3-iodo-1,2,4-oxadiazole |
| SMILES | Ic1noc(C2CCCC2)n1 |
| InChI | InChI=1S/C7H9IN2O/c8-7-9-6(11-10-7)5-3-1-2-4-5/h5H,1-4H2 |
| InChIKey | XYWVOUPRQPAGJB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.07 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|