C9H12N2O4 — CID 67840903
(5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate (PubChem CID 67840903) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate.
| Compound Name | (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 67840903 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate |
| SMILES | O=C(O)Oc1noc(C2CCCCC2)n1 |
| InChI | InChI=1S/C9H12N2O4/c12-9(13)14-8-10-7(15-11-8)6-4-2-1-3-5-6/h6H,1-5H2,(H,12,13) |
| InChIKey | XVXUTYLNBGCRIK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |