(5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate

C9H12N2O4 — CID 67840903

IUPAC(5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate
SMILESO=C(O)Oc1noc(C2CCCCC2)n1
InChIInChI=1S/C9H12N2O4/c12-9(13)14-8-10-7(15-11-8)6-4-2-1-3-5-6/h6H,1-5H2,(H,12,13)
InChIKeyXVXUTYLNBGCRIK-UHFFFAOYSA-N
MW212.20 g/mol
LogP2.17
Rot. Bonds2

About (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate

(5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate (PubChem CID 67840903) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate.

Molecular Properties

Compound Name(5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate
PubChem CID67840903
Molecular FormulaC9H12N2O4
Molecular Weight212.20 g/mol
Exact Mass212.08
IUPAC Name(5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate
SMILESO=C(O)Oc1noc(C2CCCCC2)n1
InChIInChI=1S/C9H12N2O4/c12-9(13)14-8-10-7(15-11-8)6-4-2-1-3-5-6/h6H,1-5H2,(H,12,13)
InChIKeyXVXUTYLNBGCRIK-UHFFFAOYSA-N
XLogP2.17
TPSA85.45 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.20
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate?
The IUPAC name of (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate (CID 67840903) is (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate.
What is the SMILES notation for (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate?
The canonical SMILES for (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate is O=C(O)Oc1noc(C2CCCCC2)n1.
What is the InChIKey of (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate?
The InChIKey is XVXUTYLNBGCRIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c12-9(13)14-8-10-7(15-11-8)6-4-2-1-3-5-6/h6H,1-5H2,(H,12,13).
What are the key properties of (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate?
(5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate has a molecular weight of 212.20 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyclohexyl-1,2,4-oxadiazol-3-yl) hydrogen carbonate is sourced from PubChem (CID 67840903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).