C13H25N3O — CID 57192757
5-(3-ethylnonan-3-yl)-1,2,4-oxadiazol-3-amine (PubChem CID 57192757) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 5-(3-ethylnonan-3-yl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(3-ethylnonan-3-yl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 57192757 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 5-(3-ethylnonan-3-yl)-1,2,4-oxadiazol-3-amine |
| SMILES | CCCCCCC(CC)(CC)c1nc(N)no1 |
| InChI | InChI=1S/C13H25N3O/c1-4-7-8-9-10-13(5-2,6-3)11-15-12(14)16-17-11/h4-10H2,1-3H3,(H2,14,16) |
| InChIKey | MCJWNEPNVFARRV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|