C14H17FN2 — CID 115038926
3-(1-cyclopropyl-5-fluoroindol-2-yl)propan-1-amine (PubChem CID 115038926) has the molecular formula C14H17FN2 and a molecular weight of 232.30 g/mol. Its IUPAC name is 3-(1-cyclopropyl-5-fluoroindol-2-yl)propan-1-amine.
| Compound Name | 3-(1-cyclopropyl-5-fluoroindol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 115038926 |
| Molecular Formula | C14H17FN2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 3-(1-cyclopropyl-5-fluoroindol-2-yl)propan-1-amine |
| SMILES | NCCCc1cc2cc(F)ccc2n1C1CC1 |
| InChI | InChI=1S/C14H17FN2/c15-11-3-6-14-10(8-11)9-13(2-1-7-16)17(14)12-4-5-12/h3,6,8-9,12H,1-2,4-5,7,16H2 |
| InChIKey | MEWCMRNSYKFARF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |