C24H34FN3O2 — CID 134563625
[5-fluoro-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methylcarbamic acid (PubChem CID 134563625) has the molecular formula C24H34FN3O2 and a molecular weight of 415.55 g/mol. Its IUPAC name is [5-fluoro-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methylcarbamic acid.
| Compound Name | [5-fluoro-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 134563625 |
| Molecular Formula | C24H34FN3O2 |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | [5-fluoro-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methylcarbamic acid |
| SMILES | CC(C)C1CCC(N2CCC(n3c(CNC(=O)O)cc4cc(F)ccc43)CC2)CC1 |
| InChI | InChI=1S/C24H34FN3O2/c1-16(2)17-3-6-20(7-4-17)27-11-9-21(10-12-27)28-22(15-26-24(29)30)14-18-13-19(25)5-8-23(18)28/h5,8,13-14,16-17,20-21,26H,3-4,6-7,9-12,15H2,1-2H3,(H,29,30) |
| InChIKey | ZVENCLPGJDGGLW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |