C23H34FN3 — CID 134578491
[5-fluoro-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methanamine (PubChem CID 134578491) has the molecular formula C23H34FN3 and a molecular weight of 371.54 g/mol. Its IUPAC name is [5-fluoro-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methanamine.
| Compound Name | [5-fluoro-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methanamine |
|---|---|
| PubChem CID | 134578491 |
| Molecular Formula | C23H34FN3 |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | [5-fluoro-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methanamine |
| SMILES | CC(C)C1CCC(N2CCC(n3c(CN)cc4cc(F)ccc43)CC2)CC1 |
| InChI | InChI=1S/C23H34FN3/c1-16(2)17-3-6-20(7-4-17)26-11-9-21(10-12-26)27-22(15-25)14-18-13-19(24)5-8-23(18)27/h5,8,13-14,16-17,20-21H,3-4,6-7,9-12,15,25H2,1-2H3 |
| InChIKey | RYNCQVKHHAMRCX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |