C25H35FN4O3 — CID 139547536
[5-fluoro-3-[(Z)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methyl carbamate (PubChem CID 139547536) has the molecular formula C25H35FN4O3 and a molecular weight of 458.58 g/mol. Its IUPAC name is [5-fluoro-3-[(Z)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methyl carbamate.
| Compound Name | [5-fluoro-3-[(Z)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methyl carbamate |
|---|---|
| PubChem CID | 139547536 |
| Molecular Formula | C25H35FN4O3 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | [5-fluoro-3-[(Z)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methyl carbamate |
| SMILES | CC(C)C1CCC(N2CCC(n3c(COC(N)=O)c(/C=N\O)c4cc(F)ccc43)CC2)CC1 |
| InChI | InChI=1S/C25H35FN4O3/c1-16(2)17-3-6-19(7-4-17)29-11-9-20(10-12-29)30-23-8-5-18(26)13-21(23)22(14-28-32)24(30)15-33-25(27)31/h5,8,13-14,16-17,19-20,32H,3-4,6-7,9-12,15H2,1-2H3,(H2,27,31)/b28-14- |
| InChIKey | MSCXGUSZGMWWPD-MUXKCCDJSA-N |
| XLogP | 5.04 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|