C24H35N3O2 — CID 134563523
[3-[(E)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methanol (PubChem CID 134563523) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is [3-[(E)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methanol.
| Compound Name | [3-[(E)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methanol |
|---|---|
| PubChem CID | 134563523 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | [3-[(E)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methanol |
| SMILES | CC(C)C1CCC(N2CCC(n3c(CO)c(/C=N/O)c4ccccc43)CC2)CC1 |
| InChI | InChI=1S/C24H35N3O2/c1-17(2)18-7-9-19(10-8-18)26-13-11-20(12-14-26)27-23-6-4-3-5-21(23)22(15-25-29)24(27)16-28/h3-6,15,17-20,28-29H,7-14,16H2,1-2H3/b25-15+ |
| InChIKey | IABIWINBGDCGEN-MFKUBSTISA-N |
| XLogP | 4.79 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|