C25H38N4O4S — CID 134563649
[3-(methoxyiminomethyl)-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methyl sulfamate (PubChem CID 134563649) has the molecular formula C25H38N4O4S and a molecular weight of 490.67 g/mol. Its IUPAC name is [3-(methoxyiminomethyl)-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methyl sulfamate.
| Compound Name | [3-(methoxyiminomethyl)-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 134563649 |
| Molecular Formula | C25H38N4O4S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | [3-(methoxyiminomethyl)-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methyl sulfamate |
| SMILES | CON=Cc1c(COS(N)(=O)=O)n(C2CCN(C3CCC(C(C)C)CC3)CC2)c2ccccc12 |
| InChI | InChI=1S/C25H38N4O4S/c1-18(2)19-8-10-20(11-9-19)28-14-12-21(13-15-28)29-24-7-5-4-6-22(24)23(16-27-32-3)25(29)17-33-34(26,30)31/h4-7,16,18-21H,8-15,17H2,1-3H3,(H2,26,30,31) |
| InChIKey | WOVMJQIHQZFJKD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|