C24H38N4O3S — CID 134563569
[3-(2-aminoethyl)-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-5-yl] sulfamate (PubChem CID 134563569) has the molecular formula C24H38N4O3S and a molecular weight of 462.66 g/mol. Its IUPAC name is [3-(2-aminoethyl)-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-5-yl] sulfamate.
| Compound Name | [3-(2-aminoethyl)-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-5-yl] sulfamate |
|---|---|
| PubChem CID | 134563569 |
| Molecular Formula | C24H38N4O3S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | [3-(2-aminoethyl)-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-5-yl] sulfamate |
| SMILES | CC(C)C1CCC(N2CCC(n3cc(CCN)c4cc(OS(N)(=O)=O)ccc43)CC2)CC1 |
| InChI | InChI=1S/C24H38N4O3S/c1-17(2)18-3-5-20(6-4-18)27-13-10-21(11-14-27)28-16-19(9-12-25)23-15-22(7-8-24(23)28)31-32(26,29)30/h7-8,15-18,20-21H,3-6,9-14,25H2,1-2H3,(H2,26,29,30) |
| InChIKey | DNFKNRUUXMXJNJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |