C16H22N4O2 — CID 139331762
[3-(2-aminoethyl)-1-piperidin-4-ylindol-5-yl] carbamate (PubChem CID 139331762) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is [3-(2-aminoethyl)-1-piperidin-4-ylindol-5-yl] carbamate.
| Compound Name | [3-(2-aminoethyl)-1-piperidin-4-ylindol-5-yl] carbamate |
|---|---|
| PubChem CID | 139331762 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | [3-(2-aminoethyl)-1-piperidin-4-ylindol-5-yl] carbamate |
| SMILES | NCCc1cn(C2CCNCC2)c2ccc(OC(N)=O)cc12 |
| InChI | InChI=1S/C16H22N4O2/c17-6-3-11-10-20(12-4-7-19-8-5-12)15-2-1-13(9-14(11)15)22-16(18)21/h1-2,9-10,12,19H,3-8,17H2,(H2,18,21) |
| InChIKey | CABUYVRLRKMKME-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |