C20H28N4O2 — CID 139331775
[1-piperidin-4-yl-3-(pyrrolidin-1-ylmethyl)indol-5-yl] N-methylcarbamate (PubChem CID 139331775) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is [1-piperidin-4-yl-3-(pyrrolidin-1-ylmethyl)indol-5-yl] N-methylcarbamate.
| Compound Name | [1-piperidin-4-yl-3-(pyrrolidin-1-ylmethyl)indol-5-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 139331775 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | [1-piperidin-4-yl-3-(pyrrolidin-1-ylmethyl)indol-5-yl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc2c(c1)c(CN1CCCC1)cn2C1CCNCC1 |
| InChI | InChI=1S/C20H28N4O2/c1-21-20(25)26-17-4-5-19-18(12-17)15(13-23-10-2-3-11-23)14-24(19)16-6-8-22-9-7-16/h4-5,12,14,16,22H,2-3,6-11,13H2,1H3,(H,21,25) |
| InChIKey | JUJSSBMXXRQLBQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |