C26H40N4O3S — CID 139547433
[1-[1-(4-ethylcyclohexyl)piperidin-4-yl]-3-(pyrrolidin-1-ylmethyl)indol-5-yl] sulfamate (PubChem CID 139547433) has the molecular formula C26H40N4O3S and a molecular weight of 488.70 g/mol. Its IUPAC name is [1-[1-(4-ethylcyclohexyl)piperidin-4-yl]-3-(pyrrolidin-1-ylmethyl)indol-5-yl] sulfamate.
| Compound Name | [1-[1-(4-ethylcyclohexyl)piperidin-4-yl]-3-(pyrrolidin-1-ylmethyl)indol-5-yl] sulfamate |
|---|---|
| PubChem CID | 139547433 |
| Molecular Formula | C26H40N4O3S |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | [1-[1-(4-ethylcyclohexyl)piperidin-4-yl]-3-(pyrrolidin-1-ylmethyl)indol-5-yl] sulfamate |
| SMILES | CCC1CCC(N2CCC(n3cc(CN4CCCC4)c4cc(OS(N)(=O)=O)ccc43)CC2)CC1 |
| InChI | InChI=1S/C26H40N4O3S/c1-2-20-5-7-22(8-6-20)29-15-11-23(12-16-29)30-19-21(18-28-13-3-4-14-28)25-17-24(9-10-26(25)30)33-34(27,31)32/h9-10,17,19-20,22-23H,2-8,11-16,18H2,1H3,(H2,27,31,32) |
| InChIKey | XNYADQHHWYGZRG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |