C18H22N2O5 — CID 69024914
6-[2-(3-aminopropoxy)ethoxy]-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 69024914) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 6-[2-(3-aminopropoxy)ethoxy]-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 6-[2-(3-aminopropoxy)ethoxy]-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 69024914 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 6-[2-(3-aminopropoxy)ethoxy]-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | NCCCOCCOc1ccc2c(c1)c(=O)c(C(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C18H22N2O5/c19-6-1-7-24-8-9-25-13-4-5-16-14(10-13)17(21)15(18(22)23)11-20(16)12-2-3-12/h4-5,10-12H,1-3,6-9,19H2,(H,22,23) |
| InChIKey | JCRCDXTWZCVBBV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|