C16H13FN2O3 — CID 139622136
7-(3-aminoprop-1-ynyl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 139622136) has the molecular formula C16H13FN2O3 and a molecular weight of 300.29 g/mol. Its IUPAC name is 7-(3-aminoprop-1-ynyl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(3-aminoprop-1-ynyl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 139622136 |
| Molecular Formula | C16H13FN2O3 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 7-(3-aminoprop-1-ynyl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | NCC#Cc1cc2c(cc1F)c(=O)c(C(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C16H13FN2O3/c17-13-7-11-14(6-9(13)2-1-5-18)19(10-3-4-10)8-12(15(11)20)16(21)22/h6-8,10H,3-5,18H2,(H,21,22) |
| InChIKey | AVJPEIVLDIHBAO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|