C19H25N3O5 — CID 68798582
1-cyclopropyl-7-(dimethylamino)-6-[2-(2-hydroxyethoxy)ethylamino]-4-oxoquinoline-3-carboxylic acid (PubChem CID 68798582) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-cyclopropyl-7-(dimethylamino)-6-[2-(2-hydroxyethoxy)ethylamino]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-7-(dimethylamino)-6-[2-(2-hydroxyethoxy)ethylamino]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 68798582 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-cyclopropyl-7-(dimethylamino)-6-[2-(2-hydroxyethoxy)ethylamino]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CN(C)c1cc2c(cc1NCCOCCO)c(=O)c(C(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C19H25N3O5/c1-21(2)17-10-16-13(9-15(17)20-5-7-27-8-6-23)18(24)14(19(25)26)11-22(16)12-3-4-12/h9-12,20,23H,3-8H2,1-2H3,(H,25,26) |
| InChIKey | YDAQXITXDLQWPN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|