C18H18ClN3O4 — CID 53376683
7-chloro-6-[2-(2-cyanoethoxy)ethylamino]-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 53376683) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is 7-chloro-6-[2-(2-cyanoethoxy)ethylamino]-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-chloro-6-[2-(2-cyanoethoxy)ethylamino]-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 53376683 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 7-chloro-6-[2-(2-cyanoethoxy)ethylamino]-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | N#CCCOCCNc1cc2c(=O)c(C(=O)O)cn(C3CC3)c2cc1Cl |
| InChI | InChI=1S/C18H18ClN3O4/c19-14-9-16-12(8-15(14)21-5-7-26-6-1-4-20)17(23)13(18(24)25)10-22(16)11-2-3-11/h8-11,21H,1-3,5-7H2,(H,24,25) |
| InChIKey | PLZABSGWRHXXQP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|