C19H23ClN2O7 — CID 53376795
6-[2-[2-(2-carboxyethoxy)ethoxy]ethylamino]-7-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 53376795) has the molecular formula C19H23ClN2O7 and a molecular weight of 426.85 g/mol. Its IUPAC name is 6-[2-[2-(2-carboxyethoxy)ethoxy]ethylamino]-7-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 6-[2-[2-(2-carboxyethoxy)ethoxy]ethylamino]-7-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 53376795 |
| Molecular Formula | C19H23ClN2O7 |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 6-[2-[2-(2-carboxyethoxy)ethoxy]ethylamino]-7-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(NCCOCCOCCC(=O)O)c(Cl)cc21 |
| InChI | InChI=1S/C19H23ClN2O7/c1-2-22-11-13(19(26)27)18(25)12-9-15(14(20)10-16(12)22)21-4-6-29-8-7-28-5-3-17(23)24/h9-11,21H,2-8H2,1H3,(H,23,24)(H,26,27) |
| InChIKey | XBTYDQUZNUSQQO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|