C20H24ClN3O6 — CID 143325334
6-[2-[2-(3-amino-3-oxopropoxy)ethoxy]ethylamino]-7-chloro-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 143325334) has the molecular formula C20H24ClN3O6 and a molecular weight of 437.88 g/mol. Its IUPAC name is 6-[2-[2-(3-amino-3-oxopropoxy)ethoxy]ethylamino]-7-chloro-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 6-[2-[2-(3-amino-3-oxopropoxy)ethoxy]ethylamino]-7-chloro-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 143325334 |
| Molecular Formula | C20H24ClN3O6 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 6-[2-[2-(3-amino-3-oxopropoxy)ethoxy]ethylamino]-7-chloro-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | NC(=O)CCOCCOCCNc1cc2c(=O)c(C(=O)O)cn(C3CC3)c2cc1Cl |
| InChI | InChI=1S/C20H24ClN3O6/c21-15-10-17-13(19(26)14(20(27)28)11-24(17)12-1-2-12)9-16(15)23-4-6-30-8-7-29-5-3-18(22)25/h9-12,23H,1-8H2,(H2,22,25)(H,27,28) |
| InChIKey | POHYNDFKFLYVOT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|