C32H34FN3O8 — CID 122186570
1-cyclopropyl-6-fluoro-4-oxo-7-[4-[2-[2-[2-(2-oxochromen-7-yl)oxyethoxy]ethoxy]ethyl]piperazin-1-yl]quinoline-3-carboxylic acid (PubChem CID 122186570) has the molecular formula C32H34FN3O8 and a molecular weight of 607.64 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[2-[2-[2-(2-oxochromen-7-yl)oxyethoxy]ethoxy]ethyl]piperazin-1-yl]quinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[2-[2-[2-(2-oxochromen-7-yl)oxyethoxy]ethoxy]ethyl]piperazin-1-yl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 122186570 |
| Molecular Formula | C32H34FN3O8 |
| Molecular Weight | 607.64 g/mol |
| Exact Mass | 607.23 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[2-[2-[2-(2-oxochromen-7-yl)oxyethoxy]ethoxy]ethyl]piperazin-1-yl]quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2cc(N3CCN(CCOCCOCCOc4ccc5ccc(=O)oc5c4)CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C32H34FN3O8/c33-26-18-24-27(36(22-3-4-22)20-25(31(24)38)32(39)40)19-28(26)35-9-7-34(8-10-35)11-12-41-13-14-42-15-16-43-23-5-1-21-2-6-30(37)44-29(21)17-23/h1-2,5-6,17-20,22H,3-4,7-16H2,(H,39,40) |
| InChIKey | VEDLPUCRYQSTCU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|