C29H33BFN3O6 — CID 58277123
1-cyclopropyl-7-[4-[3-[(3-ethyl-1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]propyl]piperazin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 58277123) has the molecular formula C29H33BFN3O6 and a molecular weight of 549.41 g/mol. Its IUPAC name is 1-cyclopropyl-7-[4-[3-[(3-ethyl-1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]propyl]piperazin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-7-[4-[3-[(3-ethyl-1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]propyl]piperazin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 58277123 |
| Molecular Formula | C29H33BFN3O6 |
| Molecular Weight | 549.41 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 1-cyclopropyl-7-[4-[3-[(3-ethyl-1-hydroxy-3H-2,1-benzoxaborol-7-yl)oxy]propyl]piperazin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCC1OB(O)c2c(OCCCN3CCN(c4cc5c(cc4F)c(=O)c(C(=O)O)cn5C4CC4)CC3)cccc21 |
| InChI | InChI=1S/C29H33BFN3O6/c1-2-25-19-5-3-6-26(27(19)30(38)40-25)39-14-4-9-32-10-12-33(13-11-32)24-16-23-20(15-22(24)31)28(35)21(29(36)37)17-34(23)18-7-8-18/h3,5-6,15-18,25,38H,2,4,7-14H2,1H3,(H,36,37) |
| InChIKey | DSXRYWLHQFMIPL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|