C28H30BFN4O8 — CID 58277135
1-cyclopropyl-6-fluoro-7-[4-[3-[[1-hydroxy-3-(nitromethyl)-3H-2,1-benzoxaborol-7-yl]oxy]propyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 58277135) has the molecular formula C28H30BFN4O8 and a molecular weight of 580.38 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-[4-[3-[[1-hydroxy-3-(nitromethyl)-3H-2,1-benzoxaborol-7-yl]oxy]propyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-7-[4-[3-[[1-hydroxy-3-(nitromethyl)-3H-2,1-benzoxaborol-7-yl]oxy]propyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 58277135 |
| Molecular Formula | C28H30BFN4O8 |
| Molecular Weight | 580.38 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-[4-[3-[[1-hydroxy-3-(nitromethyl)-3H-2,1-benzoxaborol-7-yl]oxy]propyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2cc(N3CCN(CCCOc4cccc5c4B(O)OC5C[N+](=O)[O-])CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C28H30BFN4O8/c30-21-13-19-22(33(17-5-6-17)15-20(27(19)35)28(36)37)14-23(21)32-10-8-31(9-11-32)7-2-12-41-24-4-1-3-18-25(16-34(39)40)42-29(38)26(18)24/h1,3-4,13-15,17,25,38H,2,5-12,16H2,(H,36,37) |
| InChIKey | KNLVBVKGPKYBMK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 147.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|