C31H41N5O3 — CID 139547532
benzyl N-[[3-[(Z)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]pyrrolo[2,3-b]pyridin-2-yl]methyl]carbamate (PubChem CID 139547532) has the molecular formula C31H41N5O3 and a molecular weight of 531.70 g/mol. Its IUPAC name is benzyl N-[[3-[(Z)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]pyrrolo[2,3-b]pyridin-2-yl]methyl]carbamate.
| Compound Name | benzyl N-[[3-[(Z)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]pyrrolo[2,3-b]pyridin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 139547532 |
| Molecular Formula | C31H41N5O3 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | benzyl N-[[3-[(Z)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]pyrrolo[2,3-b]pyridin-2-yl]methyl]carbamate |
| SMILES | CC(C)C1CCC(N2CCC(n3c(CNC(=O)OCc4ccccc4)c(/C=N\O)c4cccnc43)CC2)CC1 |
| InChI | InChI=1S/C31H41N5O3/c1-22(2)24-10-12-25(13-11-24)35-17-14-26(15-18-35)36-29(28(19-34-38)27-9-6-16-32-30(27)36)20-33-31(37)39-21-23-7-4-3-5-8-23/h3-9,16,19,22,24-26,38H,10-15,17-18,20-21H2,1-2H3,(H,33,37)/b34-19- |
| InChIKey | MUTNXCXYRTVFLX-FZKWRIDDSA-N |
| XLogP | 6.12 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|