C30H45N3O3 — CID 134578307
2-[3-[(E)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 134578307) has the molecular formula C30H45N3O3 and a molecular weight of 495.71 g/mol. Its IUPAC name is 2-[3-[(E)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[3-[(E)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134578307 |
| Molecular Formula | C30H45N3O3 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.35 |
| IUPAC Name | 2-[3-[(E)-hydroxyiminomethyl]-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)C1CCC(N2CCC(n3c(CCOC(=O)C(C)(C)C)c(/C=N/O)c4ccccc43)CC2)CC1 |
| InChI | InChI=1S/C30H45N3O3/c1-21(2)22-10-12-23(13-11-22)32-17-14-24(15-18-32)33-27-9-7-6-8-25(27)26(20-31-35)28(33)16-19-36-29(34)30(3,4)5/h6-9,20-24,35H,10-19H2,1-5H3/b31-20+ |
| InChIKey | RQFMYTYPEBMRFS-AJBULDERSA-N |
| XLogP | 6.43 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|