C11H14ClF2N — CID 115039893
2-benzyl-4,4-difluoropyrrolidine;hydrochloride (PubChem CID 115039893) has the molecular formula C11H14ClF2N and a molecular weight of 233.69 g/mol. Its IUPAC name is 2-benzyl-4,4-difluoropyrrolidine;hydrochloride.
| Compound Name | 2-benzyl-4,4-difluoropyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 115039893 |
| Molecular Formula | C11H14ClF2N |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-benzyl-4,4-difluoropyrrolidine;hydrochloride |
| SMILES | Cl.FC1(F)CNC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C11H13F2N.ClH/c12-11(13)7-10(14-8-11)6-9-4-2-1-3-5-9;/h1-5,10,14H,6-8H2;1H |
| InChIKey | IXAKTKLRHMSEDL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |