C13H15FN2O — CID 115040112
5-(2-tert-butyl-1,3-oxazol-4-yl)-2-fluoroaniline (PubChem CID 115040112) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is 5-(2-tert-butyl-1,3-oxazol-4-yl)-2-fluoroaniline.
| Compound Name | 5-(2-tert-butyl-1,3-oxazol-4-yl)-2-fluoroaniline |
|---|---|
| PubChem CID | 115040112 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 5-(2-tert-butyl-1,3-oxazol-4-yl)-2-fluoroaniline |
| SMILES | CC(C)(C)c1nc(-c2ccc(F)c(N)c2)co1 |
| InChI | InChI=1S/C13H15FN2O/c1-13(2,3)12-16-11(7-17-12)8-4-5-9(14)10(15)6-8/h4-7H,15H2,1-3H3 |
| InChIKey | WLQNXYGJXHNPFX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|