C12H8ClFN2 — CID 115040554
1-chloro-6-fluoro-9-methylpyrido[3,4-b]indole (PubChem CID 115040554) has the molecular formula C12H8ClFN2 and a molecular weight of 234.66 g/mol. Its IUPAC name is 1-chloro-6-fluoro-9-methylpyrido[3,4-b]indole.
| Compound Name | 1-chloro-6-fluoro-9-methylpyrido[3,4-b]indole |
|---|---|
| PubChem CID | 115040554 |
| Molecular Formula | C12H8ClFN2 |
| Molecular Weight | 234.66 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 1-chloro-6-fluoro-9-methylpyrido[3,4-b]indole |
| SMILES | Cn1c2ccc(F)cc2c2ccnc(Cl)c21 |
| InChI | InChI=1S/C12H8ClFN2/c1-16-10-3-2-7(14)6-9(10)8-4-5-15-12(13)11(8)16/h2-6H,1H3 |
| InChIKey | IMPWAUCNFFZKCA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|