C14H20OS — CID 115041780
3-[1-(propan-2-ylsulfanylmethyl)cyclobutyl]phenol (PubChem CID 115041780) has the molecular formula C14H20OS and a molecular weight of 236.38 g/mol. Its IUPAC name is 3-[1-(propan-2-ylsulfanylmethyl)cyclobutyl]phenol.
| Compound Name | 3-[1-(propan-2-ylsulfanylmethyl)cyclobutyl]phenol |
|---|---|
| PubChem CID | 115041780 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3-[1-(propan-2-ylsulfanylmethyl)cyclobutyl]phenol |
| SMILES | CC(C)SCC1(c2cccc(O)c2)CCC1 |
| InChI | InChI=1S/C14H20OS/c1-11(2)16-10-14(7-4-8-14)12-5-3-6-13(15)9-12/h3,5-6,9,11,15H,4,7-8,10H2,1-2H3 |
| InChIKey | LKCSMTYNRUDOLA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |