C15H17N3 — CID 115043154
6-methyl-1-propan-2-yl-9H-pyrido[3,4-b]indol-3-amine (PubChem CID 115043154) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 6-methyl-1-propan-2-yl-9H-pyrido[3,4-b]indol-3-amine.
| Compound Name | 6-methyl-1-propan-2-yl-9H-pyrido[3,4-b]indol-3-amine |
|---|---|
| PubChem CID | 115043154 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 6-methyl-1-propan-2-yl-9H-pyrido[3,4-b]indol-3-amine |
| SMILES | Cc1ccc2[nH]c3c(C(C)C)nc(N)cc3c2c1 |
| InChI | InChI=1S/C15H17N3/c1-8(2)14-15-11(7-13(16)18-14)10-6-9(3)4-5-12(10)17-15/h4-8,17H,1-3H3,(H2,16,18) |
| InChIKey | PHEUUWXOXNXQHD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |