C9H9BrF2N2 — CID 115049047
3-(4-bromophenyl)-2,2-difluoropropanimidamide (PubChem CID 115049047) has the molecular formula C9H9BrF2N2 and a molecular weight of 263.08 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2,2-difluoropropanimidamide.
| Compound Name | 3-(4-bromophenyl)-2,2-difluoropropanimidamide |
|---|---|
| PubChem CID | 115049047 |
| Molecular Formula | C9H9BrF2N2 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 3-(4-bromophenyl)-2,2-difluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(F)(F)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H9BrF2N2/c10-7-3-1-6(2-4-7)5-9(11,12)8(13)14/h1-4H,5H2,(H3,13,14) |
| InChIKey | ZNMYYGVWPSNXHY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|