C14H14F3NO — CID 115050167
1-(1-isocyanato-3,3-dimethylcyclobutyl)-2-(trifluoromethyl)benzene (PubChem CID 115050167) has the molecular formula C14H14F3NO and a molecular weight of 269.27 g/mol. Its IUPAC name is 1-(1-isocyanato-3,3-dimethylcyclobutyl)-2-(trifluoromethyl)benzene.
| Compound Name | 1-(1-isocyanato-3,3-dimethylcyclobutyl)-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 115050167 |
| Molecular Formula | C14H14F3NO |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-(1-isocyanato-3,3-dimethylcyclobutyl)-2-(trifluoromethyl)benzene |
| SMILES | CC1(C)CC(N=C=O)(c2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H14F3NO/c1-12(2)7-13(8-12,18-9-19)10-5-3-4-6-11(10)14(15,16)17/h3-6H,7-8H2,1-2H3 |
| InChIKey | UQZIDQCAIRZLKC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|