C12H10F3NO2 — CID 115047991
3-isocyanato-3-methyl-8-(trifluoromethyl)-2,4-dihydrochromene (PubChem CID 115047991) has the molecular formula C12H10F3NO2 and a molecular weight of 257.21 g/mol. Its IUPAC name is 3-isocyanato-3-methyl-8-(trifluoromethyl)-2,4-dihydrochromene.
| Compound Name | 3-isocyanato-3-methyl-8-(trifluoromethyl)-2,4-dihydrochromene |
|---|---|
| PubChem CID | 115047991 |
| Molecular Formula | C12H10F3NO2 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-isocyanato-3-methyl-8-(trifluoromethyl)-2,4-dihydrochromene |
| SMILES | CC1(N=C=O)COc2c(cccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C12H10F3NO2/c1-11(16-7-17)5-8-3-2-4-9(12(13,14)15)10(8)18-6-11/h2-4H,5-6H2,1H3 |
| InChIKey | OTPDTQLPAZFPTE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|