3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid

C12H11F3O3 — CID 135311406

IUPAC3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid
SMILESCCC1(C(=O)O)COc2c(C(F)(F)F)cccc21
InChIInChI=1S/C12H11F3O3/c1-2-11(10(16)17)6-18-9-7(11)4-3-5-8(9)12(13,14)15/h3-5H,2,6H2,1H3,(H,16,17)
InChIKeyOGRQYGLAMZKFHO-UHFFFAOYSA-N
MW260.21 g/mol
LogP2.83
Rot. Bonds2

About 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid

3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid (PubChem CID 135311406) has the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. Its IUPAC name is 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid.

Molecular Properties

Compound Name3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid
PubChem CID135311406
Molecular FormulaC12H11F3O3
Molecular Weight260.21 g/mol
Exact Mass260.07
IUPAC Name3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid
SMILESCCC1(C(=O)O)COc2c(C(F)(F)F)cccc21
InChIInChI=1S/C12H11F3O3/c1-2-11(10(16)17)6-18-9-7(11)4-3-5-8(9)12(13,14)15/h3-5H,2,6H2,1H3,(H,16,17)
InChIKeyOGRQYGLAMZKFHO-UHFFFAOYSA-N
XLogP2.83
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.21
LogP ≤ 52.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid?
The IUPAC name of 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid (CID 135311406) is 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid.
What is the SMILES notation for 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid?
The canonical SMILES for 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid is CCC1(C(=O)O)COc2c(C(F)(F)F)cccc21.
What is the InChIKey of 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid?
The InChIKey is OGRQYGLAMZKFHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3O3/c1-2-11(10(16)17)6-18-9-7(11)4-3-5-8(9)12(13,14)15/h3-5H,2,6H2,1H3,(H,16,17).
What are the key properties of 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid?
3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid has a molecular weight of 260.21 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid is sourced from PubChem (CID 135311406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).