C12H11F3O3 — CID 135311406
3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid (PubChem CID 135311406) has the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. Its IUPAC name is 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid.
| Compound Name | 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 135311406 |
| Molecular Formula | C12H11F3O3 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3-ethyl-7-(trifluoromethyl)-2H-1-benzofuran-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)COc2c(C(F)(F)F)cccc21 |
| InChI | InChI=1S/C12H11F3O3/c1-2-11(10(16)17)6-18-9-7(11)4-3-5-8(9)12(13,14)15/h3-5H,2,6H2,1H3,(H,16,17) |
| InChIKey | OGRQYGLAMZKFHO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |