C10H9BrF3N — CID 115051480
(E)-3-(2-bromophenyl)-4,4,4-trifluorobut-2-en-1-amine (PubChem CID 115051480) has the molecular formula C10H9BrF3N and a molecular weight of 280.09 g/mol. Its IUPAC name is (E)-3-(2-bromophenyl)-4,4,4-trifluorobut-2-en-1-amine.
| Compound Name | (E)-3-(2-bromophenyl)-4,4,4-trifluorobut-2-en-1-amine |
|---|---|
| PubChem CID | 115051480 |
| Molecular Formula | C10H9BrF3N |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | (E)-3-(2-bromophenyl)-4,4,4-trifluorobut-2-en-1-amine |
| SMILES | NC/C=C(\c1ccccc1Br)C(F)(F)F |
| InChI | InChI=1S/C10H9BrF3N/c11-9-4-2-1-3-7(9)8(5-6-15)10(12,13)14/h1-5H,6,15H2/b8-5+ |
| InChIKey | UJBLHMVLUBBBPH-VMPITWQZSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |